C26H37N5O8 — CID 138694063
tert-butyl N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 138694063) has the molecular formula C26H37N5O8 and a molecular weight of 547.61 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138694063 |
| Molecular Formula | C26H37N5O8 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H37N5O8/c1-26(2,3)39-25(36)28-9-11-38-13-12-37-10-8-27-24(35)29-15-17-4-5-19-18(14-17)16-31(23(19)34)20-6-7-21(32)30-22(20)33/h4-5,14,20H,6-13,15-16H2,1-3H3,(H,28,36)(H2,27,29,35)(H,30,32,33) |
| InChIKey | JRBIBWOJKHFOOS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|