C24H25N3O4 — CID 162670524
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methyl-2-phenylpropanamide (PubChem CID 162670524) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methyl-2-phenylpropanamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 162670524 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methyl-2-phenylpropanamide |
| SMILES | CC(C)(C(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O4/c1-24(2,17-6-4-3-5-7-17)23(31)25-13-15-8-9-18-16(12-15)14-27(22(18)30)19-10-11-20(28)26-21(19)29/h3-9,12,19H,10-11,13-14H2,1-2H3,(H,25,31)(H,26,28,29) |
| InChIKey | NOJKJVONTQZKHX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|