C22H18F3N3O4 — CID 175954638
N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(3-fluorophenyl)acetamide (PubChem CID 175954638) has the molecular formula C22H18F3N3O4 and a molecular weight of 445.40 g/mol. Its IUPAC name is N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 175954638 |
| Molecular Formula | C22H18F3N3O4 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(3-fluorophenyl)acetamide |
| SMILES | O=C1CC[C@@H](N2Cc3cc(CNC(=O)C(F)(F)c4cccc(F)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H18F3N3O4/c23-15-3-1-2-14(9-15)22(24,25)21(32)26-10-12-4-5-16-13(8-12)11-28(20(16)31)17-6-7-18(29)27-19(17)30/h1-5,8-9,17H,6-7,10-11H2,(H,26,32)(H,27,29,30)/t17-/m1/s1 |
| InChIKey | SBVXMVCDPWXTDN-QGZVFWFLSA-N |
| XLogP | 1.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|