C28H22F3N3O4 — CID 118646938
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]acetamide (PubChem CID 118646938) has the molecular formula C28H22F3N3O4 and a molecular weight of 521.50 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]acetamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 118646938 |
| Molecular Formula | C28H22F3N3O4 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]acetamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(-c5ccc(F)cc5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H22F3N3O4/c29-21-8-4-18(5-9-21)17-2-6-20(7-3-17)28(30,31)27(38)32-14-16-1-10-22-19(13-16)15-34(26(22)37)23-11-12-24(35)33-25(23)36/h1-10,13,23H,11-12,14-15H2,(H,32,38)(H,33,35,36) |
| InChIKey | UGVHSQJMBSIJLL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|