C23H20F3N3O4 — CID 135326069
N-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-fluorophenyl)acetamide (PubChem CID 135326069) has the molecular formula C23H20F3N3O4 and a molecular weight of 459.42 g/mol. Its IUPAC name is N-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135326069 |
| Molecular Formula | C23H20F3N3O4 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-fluorophenyl)acetamide |
| SMILES | O=C1CCCC(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(F)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H20F3N3O4/c24-16-7-5-15(6-8-16)23(25,26)22(33)27-11-13-4-9-17-14(10-13)12-29(21(17)32)18-2-1-3-19(30)28-20(18)31/h4-10,18H,1-3,11-12H2,(H,27,33)(H,28,30,31) |
| InChIKey | WGZUCMZNQLMQNZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|