C22H21F2N5O4 — CID 130219446
2-(3,4-diaminophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide (PubChem CID 130219446) has the molecular formula C22H21F2N5O4 and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-(3,4-diaminophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | 2-(3,4-diaminophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 130219446 |
| Molecular Formula | C22H21F2N5O4 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-(3,4-diaminophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
| SMILES | Nc1ccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1N |
| InChI | InChI=1S/C22H21F2N5O4/c23-22(24,13-2-4-15(25)16(26)8-13)21(33)27-9-11-1-3-14-12(7-11)10-29(20(14)32)17-5-6-18(30)28-19(17)31/h1-4,7-8,17H,5-6,9-10,25-26H2,(H,27,33)(H,28,30,31) |
| InChIKey | HJXRTSUQZQBZNL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|