C23H20ClF2N3O4 — CID 118646974
2-(3-chloro-4-methylphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide (PubChem CID 118646974) has the molecular formula C23H20ClF2N3O4 and a molecular weight of 475.88 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | 2-(3-chloro-4-methylphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 118646974 |
| Molecular Formula | C23H20ClF2N3O4 |
| Molecular Weight | 475.88 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
| SMILES | Cc1ccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C23H20ClF2N3O4/c1-12-2-4-15(9-17(12)24)23(25,26)22(33)27-10-13-3-5-16-14(8-13)11-29(21(16)32)18-6-7-19(30)28-20(18)31/h2-5,8-9,18H,6-7,10-11H2,1H3,(H,27,33)(H,28,30,31) |
| InChIKey | NYOULAILGSKVMS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|