C23H21F2N3O6S — CID 175954644
N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 175954644) has the molecular formula C23H21F2N3O6S and a molecular weight of 505.50 g/mol. Its IUPAC name is N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 175954644 |
| Molecular Formula | C23H21F2N3O6S |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN([C@@H]2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C23H21F2N3O6S/c1-35(33,34)16-5-3-15(4-6-16)23(24,25)22(32)26-11-13-2-7-17-14(10-13)12-28(21(17)31)18-8-9-19(29)27-20(18)30/h2-7,10,18H,8-9,11-12H2,1H3,(H,26,32)(H,27,29,30)/t18-/m1/s1 |
| InChIKey | YNEFVZUMWDLSFV-GOSISDBHSA-N |
| XLogP | 1.26 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|