C22H21N3O6S — CID 44538015
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-methylsulfonylbenzamide (PubChem CID 44538015) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 44538015 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C22H21N3O6S/c1-32(30,31)16-5-3-14(4-6-16)20(27)23-11-13-2-7-17-15(10-13)12-25(22(17)29)18-8-9-19(26)24-21(18)28/h2-7,10,18H,8-9,11-12H2,1H3,(H,23,27)(H,24,26,28) |
| InChIKey | RSENYTRKWFZKJP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|