C20H19BrN4O4 — CID 168880077
4-bromo-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 168880077) has the molecular formula C20H19BrN4O4 and a molecular weight of 459.30 g/mol. Its IUPAC name is 4-bromo-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 168880077 |
| Molecular Formula | C20H19BrN4O4 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 4-bromo-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H19BrN4O4/c1-24-10-13(21)7-16(24)18(27)22-8-11-2-3-14-12(6-11)9-25(20(14)29)15-4-5-17(26)23-19(15)28/h2-3,6-7,10,15H,4-5,8-9H2,1H3,(H,22,27)(H,23,26,28) |
| InChIKey | KZKDHYSLHOIPME-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|