C23H21BrN4O5 — CID 172624794
(2E)-3-(4-bromophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-hydroxyiminopropanamide (PubChem CID 172624794) has the molecular formula C23H21BrN4O5 and a molecular weight of 513.35 g/mol. Its IUPAC name is (2E)-3-(4-bromophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(4-bromophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 172624794 |
| Molecular Formula | C23H21BrN4O5 |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | (2E)-3-(4-bromophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-hydroxyiminopropanamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)/C(Cc4ccc(Br)cc4)=N/O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H21BrN4O5/c24-16-4-1-13(2-5-16)10-18(27-33)21(30)25-11-14-3-6-17-15(9-14)12-28(23(17)32)19-7-8-20(29)26-22(19)31/h1-6,9,19,33H,7-8,10-12H2,(H,25,30)(H,26,29,31)/b27-18+ |
| InChIKey | VTCJNNKXXHGPMU-OVVQPSECSA-N |
| XLogP | 1.90 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|