C25H23F3N4O6 — CID 172624793
(2E)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxyimino-3-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 172624793) has the molecular formula C25H23F3N4O6 and a molecular weight of 532.48 g/mol. Its IUPAC name is (2E)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxyimino-3-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | (2E)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxyimino-3-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 172624793 |
| Molecular Formula | C25H23F3N4O6 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | (2E)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxyimino-3-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | CO/N=C(\Cc1ccc(OC(F)(F)F)cc1)C(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H23F3N4O6/c1-37-31-19(11-14-2-5-17(6-3-14)38-25(26,27)28)22(34)29-12-15-4-7-18-16(10-15)13-32(24(18)36)20-8-9-21(33)30-23(20)35/h2-7,10,20H,8-9,11-13H2,1H3,(H,29,34)(H,30,33,35)/b31-19+ |
| InChIKey | YBVYIEYCCXRRIL-ZCTHSVRISA-N |
| XLogP | 2.21 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|