C24H23F2N3O6 — CID 118647015
2-(2,5-dimethoxyphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide (PubChem CID 118647015) has the molecular formula C24H23F2N3O6 and a molecular weight of 487.46 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 118647015 |
| Molecular Formula | C24H23F2N3O6 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
| SMILES | COc1ccc(OC)c(C(F)(F)C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C24H23F2N3O6/c1-34-15-4-7-19(35-2)17(10-15)24(25,26)23(33)27-11-13-3-5-16-14(9-13)12-29(22(16)32)18-6-8-20(30)28-21(18)31/h3-5,7,9-10,18H,6,8,11-12H2,1-2H3,(H,27,33)(H,28,30,31) |
| InChIKey | YWXQCDLFEUYGGY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|