C22H18F3N3O5 — CID 24789038
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 24789038) has the molecular formula C22H18F3N3O5 and a molecular weight of 461.40 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 24789038 |
| Molecular Formula | C22H18F3N3O5 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4ccc(OC(F)(F)F)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H18F3N3O5/c23-22(24,25)33-15-4-2-13(3-5-15)19(30)26-10-12-1-6-16-14(9-12)11-28(21(16)32)17-7-8-18(29)27-20(17)31/h1-6,9,17H,7-8,10-11H2,(H,26,30)(H,27,29,31) |
| InChIKey | FFNCXWRQFCQIPH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|