C23H19N5O4 — CID 168880034
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]quinoxaline-2-carboxamide (PubChem CID 168880034) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 168880034 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]quinoxaline-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4cnc5ccccc5n4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19N5O4/c29-20-8-7-19(22(31)27-20)28-12-14-9-13(5-6-15(14)23(28)32)10-25-21(30)18-11-24-16-3-1-2-4-17(16)26-18/h1-6,9,11,19H,7-8,10,12H2,(H,25,30)(H,27,29,31) |
| InChIKey | MRMBEHXMQAPIKC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|