C27H21N3O5 — CID 168880101
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 168880101) has the molecular formula C27H21N3O5 and a molecular weight of 467.48 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 168880101 |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4cc5c(ccc6ccccc65)o4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H21N3O5/c31-24-10-8-21(25(32)29-24)30-14-17-11-15(5-7-19(17)27(30)34)13-28-26(33)23-12-20-18-4-2-1-3-16(18)6-9-22(20)35-23/h1-7,9,11-12,21H,8,10,13-14H2,(H,28,33)(H,29,31,32) |
| InChIKey | MOAYHXAQJKGFCR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|