C23H24N4O4 — CID 176805340
(2S)-2-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-phenylpropanamide (PubChem CID 176805340) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is (2S)-2-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 176805340 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (2S)-2-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H24N4O4/c24-18(11-14-4-2-1-3-5-14)21(29)25-12-15-6-7-17-16(10-15)13-27(23(17)31)19-8-9-20(28)26-22(19)30/h1-7,10,18-19H,8-9,11-13,24H2,(H,25,29)(H,26,28,30)/t18-,19?/m0/s1 |
| InChIKey | ALZPXFLWWCJWBQ-OYKVQYDMSA-N |
| XLogP | 0.63 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|