C31H30N4O6 — CID 175427969
(3S)-N'-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxy-2,3-diphenylbutanediamide (PubChem CID 175427969) has the molecular formula C31H30N4O6 and a molecular weight of 554.60 g/mol. Its IUPAC name is (3S)-N'-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxy-2,3-diphenylbutanediamide.
| Compound Name | (3S)-N'-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxy-2,3-diphenylbutanediamide |
|---|---|
| PubChem CID | 175427969 |
| Molecular Formula | C31H30N4O6 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | (3S)-N'-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2-methoxy-2,3-diphenylbutanediamide |
| SMILES | COC(C(N)=O)(c1ccccc1)[C@@H](C(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C31H30N4O6/c1-41-31(30(32)40,22-10-6-3-7-11-22)26(20-8-4-2-5-9-20)28(38)33-17-19-12-13-23-21(16-19)18-35(29(23)39)24-14-15-25(36)34-27(24)37/h2-13,16,24,26H,14-15,17-18H2,1H3,(H2,32,40)(H,33,38)(H,34,36,37)/t24?,26-,31?/m1/s1 |
| InChIKey | KMVXFHODWXOEPY-YMTPMNICSA-N |
| XLogP | 1.87 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|