C27H31N5O4 — CID 167866783
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[[(3R,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methyl]urea (PubChem CID 167866783) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[[(3R,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[[(3R,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 167866783 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[[(3R,4R)-1-methyl-4-phenylpyrrolidin-3-yl]methyl]urea |
| SMILES | CN1C[C@@H](CNC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C27H31N5O4/c1-31-14-20(22(16-31)18-5-3-2-4-6-18)13-29-27(36)28-12-17-7-8-21-19(11-17)15-32(26(21)35)23-9-10-24(33)30-25(23)34/h2-8,11,20,22-23H,9-10,12-16H2,1H3,(H2,28,29,36)(H,30,33,34)/t20-,22+,23?/m1/s1 |
| InChIKey | YYEPBIQZMDCFHH-PTCKQWLISA-N |
| XLogP | 1.59 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|