C23H21N3O6 — CID 166425969
(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 166425969) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 166425969 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)N[C@@H](Cc4ccccc4)C(=O)O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H21N3O6/c27-19-9-8-18(21(29)25-19)26-12-15-11-14(6-7-16(15)22(26)30)20(28)24-17(23(31)32)10-13-4-2-1-3-5-13/h1-7,11,17-18H,8-10,12H2,(H,24,28)(H,31,32)(H,25,27,29)/t17-,18?/m0/s1 |
| InChIKey | YLOLEXBZYKFCKP-ZENAZSQFSA-N |
| XLogP | 0.87 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|