C26H27N3O4 — CID 167231155
N-[(R)-cyclopentyl(phenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 167231155) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[(R)-cyclopentyl(phenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[(R)-cyclopentyl(phenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 167231155 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[(R)-cyclopentyl(phenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)N[C@@H](c4ccccc4)C4CCCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H27N3O4/c30-22-13-12-21(25(32)27-22)29-15-19-14-18(10-11-20(19)26(29)33)24(31)28-23(17-8-4-5-9-17)16-6-2-1-3-7-16/h1-3,6-7,10-11,14,17,21,23H,4-5,8-9,12-13,15H2,(H,28,31)(H,27,30,32)/t21?,23-/m0/s1 |
| InChIKey | ZALGBJCFPWAMCI-YANBTOMASA-N |
| XLogP | 3.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|