C23H26F3N3O4 — CID 155350197
2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(3-methylcyclohexyl)ethyl]-3H-isoindole-5-carboxamide (PubChem CID 155350197) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(3-methylcyclohexyl)ethyl]-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(3-methylcyclohexyl)ethyl]-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 155350197 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(3-methylcyclohexyl)ethyl]-3H-isoindole-5-carboxamide |
| SMILES | CC1CCCC(C(NC(=O)c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C23H26F3N3O4/c1-12-3-2-4-13(9-12)19(23(24,25)26)28-20(31)14-5-6-16-15(10-14)11-29(22(16)33)17-7-8-18(30)27-21(17)32/h5-6,10,12-13,17,19H,2-4,7-9,11H2,1H3,(H,28,31)(H,27,30,32) |
| InChIKey | QYZLVSRDZNUNMN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|