C21H16ClF3N4O4 — CID 155338810
N-[1-(5-chloro-2-pyridinyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 155338810) has the molecular formula C21H16ClF3N4O4 and a molecular weight of 480.83 g/mol. Its IUPAC name is N-[1-(5-chloro-2-pyridinyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[1-(5-chloro-2-pyridinyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 155338810 |
| Molecular Formula | C21H16ClF3N4O4 |
| Molecular Weight | 480.83 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-[1-(5-chloro-2-pyridinyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)NC(c4ccc(Cl)cn4)C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H16ClF3N4O4/c22-12-2-4-14(26-8-12)17(21(23,24)25)28-18(31)10-1-3-13-11(7-10)9-29(20(13)33)15-5-6-16(30)27-19(15)32/h1-4,7-8,15,17H,5-6,9H2,(H,28,31)(H,27,30,32) |
| InChIKey | RHXHOEOGSJZRBX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|