C21H15ClF4N4O4 — CID 175584777
N-[1-(5-chloro-3-fluoro-2-pyridinyl)-1,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 175584777) has the molecular formula C21H15ClF4N4O4 and a molecular weight of 498.82 g/mol. Its IUPAC name is N-[1-(5-chloro-3-fluoro-2-pyridinyl)-1,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[1-(5-chloro-3-fluoro-2-pyridinyl)-1,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 175584777 |
| Molecular Formula | C21H15ClF4N4O4 |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-[1-(5-chloro-3-fluoro-2-pyridinyl)-1,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)NC(F)(c4ncc(Cl)cc4F)C(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H15ClF4N4O4/c22-11-6-13(23)16(27-7-11)21(26,20(24)25)29-17(32)9-1-2-12-10(5-9)8-30(19(12)34)14-3-4-15(31)28-18(14)33/h1-2,5-7,14,20H,3-4,8H2,(H,29,32)(H,28,31,33) |
| InChIKey | HFCYMUPSSXLKRU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|