C20H15ClN2O4 — CID 177251278
3-[6-(4-chlorobenzoyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177251278) has the molecular formula C20H15ClN2O4 and a molecular weight of 382.80 g/mol. Its IUPAC name is 3-[6-(4-chlorobenzoyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(4-chlorobenzoyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177251278 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-[6-(4-chlorobenzoyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)c4ccc(Cl)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H15ClN2O4/c21-14-4-1-11(2-5-14)18(25)12-3-6-15-13(9-12)10-23(20(15)27)16-7-8-17(24)22-19(16)26/h1-6,9,16H,7-8,10H2,(H,22,24,26) |
| InChIKey | ZJKZSAJAOBZIGK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|