C23H20N2O6 — CID 177251306
ethyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]benzoate (PubChem CID 177251306) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is ethyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]benzoate.
| Compound Name | ethyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]benzoate |
|---|---|
| PubChem CID | 177251306 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=O)c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C23H20N2O6/c1-2-31-23(30)14-5-3-13(4-6-14)20(27)15-7-8-17-16(11-15)12-25(22(17)29)18-9-10-19(26)24-21(18)28/h3-8,11,18H,2,9-10,12H2,1H3,(H,24,26,28) |
| InChIKey | YHNHOVGYAXZVPY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|