C27H39N5O5 — CID 178161563
ethane;ethyl 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]piperidine-1-carboxylate (PubChem CID 178161563) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is ethane;ethyl 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethane;ethyl 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161563 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | ethane;ethyl 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CC.CCOC(=O)N1CCC(N2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C25H33N5O5.C2H6/c1-2-35-25(34)29-9-7-18(8-10-29)27-11-13-28(14-12-27)19-3-4-20-17(15-19)16-30(24(20)33)21-5-6-22(31)26-23(21)32;1-2/h3-4,15,18,21H,2,5-14,16H2,1H3,(H,26,31,32);1-2H3 |
| InChIKey | CTURLCCSKHOOFL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|