C27H36N4O6 — CID 178161175
ethyl 4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methoxy]piperidine-1-carboxylate (PubChem CID 178161175) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is ethyl 4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161175 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | ethyl 4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(OCC2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C27H36N4O6/c1-2-36-27(35)30-13-9-21(10-14-30)37-17-18-7-11-29(12-8-18)20-3-4-22-19(15-20)16-31(26(22)34)23-5-6-24(32)28-25(23)33/h3-4,15,18,21,23H,2,5-14,16-17H2,1H3,(H,28,32,33) |
| InChIKey | QVYIRCLIAUCRDX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|