C30H36N6O5 — CID 170359293
3-[6-[4-[1-(4-amino-3-methoxybenzoyl)piperidin-4-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170359293) has the molecular formula C30H36N6O5 and a molecular weight of 560.66 g/mol. Its IUPAC name is 3-[6-[4-[1-(4-amino-3-methoxybenzoyl)piperidin-4-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[1-(4-amino-3-methoxybenzoyl)piperidin-4-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170359293 |
| Molecular Formula | C30H36N6O5 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 3-[6-[4-[1-(4-amino-3-methoxybenzoyl)piperidin-4-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(C(=O)N2CCC(N3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)ccc1N |
| InChI | InChI=1S/C30H36N6O5/c1-41-26-17-19(2-5-24(26)31)29(39)35-10-8-21(9-11-35)33-12-14-34(15-13-33)22-3-4-23-20(16-22)18-36(30(23)40)25-6-7-27(37)32-28(25)38/h2-5,16-17,21,25H,6-15,18,31H2,1H3,(H,32,37,38) |
| InChIKey | ITSDKPUSPFYFEA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|