C20H25ClN4O4 — CID 166410922
3-[6-[(2R,6S)-2,6-dimethylpiperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 166410922) has the molecular formula C20H25ClN4O4 and a molecular weight of 420.90 g/mol. Its IUPAC name is 3-[6-[(2R,6S)-2,6-dimethylpiperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[6-[(2R,6S)-2,6-dimethylpiperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 166410922 |
| Molecular Formula | C20H25ClN4O4 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-[6-[(2R,6S)-2,6-dimethylpiperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | C[C@@H]1CNC[C@H](C)N1C(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O.Cl |
| InChI | InChI=1S/C20H24N4O4.ClH/c1-11-8-21-9-12(2)24(11)19(27)13-3-4-15-14(7-13)10-23(20(15)28)16-5-6-17(25)22-18(16)26;/h3-4,7,11-12,16,21H,5-6,8-10H2,1-2H3,(H,22,25,26);1H/t11-,12+,16?; |
| InChIKey | QWXVCANEYGRKPI-DYQUEKMUSA-N |
| XLogP | 0.69 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|