C31H30N4O6 — CID 171829177
3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829177) has the molecular formula C31H30N4O6 and a molecular weight of 554.60 g/mol. Its IUPAC name is 3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829177 |
| Molecular Formula | C31H30N4O6 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)N4CCN(C(c5ccc(O)cc5)c5ccc(O)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H30N4O6/c36-23-6-1-19(2-7-23)28(20-3-8-24(37)9-4-20)33-13-15-34(16-14-33)30(40)21-5-10-25-22(17-21)18-35(31(25)41)26-11-12-27(38)32-29(26)39/h1-10,17,26,28,36-37H,11-16,18H2,(H,32,38,39) |
| InChIKey | MAPGLCNJNCPYKM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|