C30H27N5O5 — CID 171829167
2-(2,6-dioxopiperidin-3-yl)-5-[4-[phenyl(pyridin-3-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 171829167) has the molecular formula C30H27N5O5 and a molecular weight of 537.58 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[phenyl(pyridin-3-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[phenyl(pyridin-3-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171829167 |
| Molecular Formula | C30H27N5O5 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[phenyl(pyridin-3-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C(=O)N4CCN(C(c5ccccc5)c5cccnc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H27N5O5/c36-25-11-10-24(27(37)32-25)35-29(39)22-9-8-20(17-23(22)30(35)40)28(38)34-15-13-33(14-16-34)26(19-5-2-1-3-6-19)21-7-4-12-31-18-21/h1-9,12,17-18,24,26H,10-11,13-16H2,(H,32,36,37) |
| InChIKey | ALXVRWHMGNHSQM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|