C31H28F2N4O4 — CID 171828953
5-[[4-[bis(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 171828953) has the molecular formula C31H28F2N4O4 and a molecular weight of 558.59 g/mol. Its IUPAC name is 5-[[4-[bis(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-[bis(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 171828953 |
| Molecular Formula | C31H28F2N4O4 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 5-[[4-[bis(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CCN(C(c5cccc(F)c5)c5cccc(F)c5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H28F2N4O4/c32-22-5-1-3-20(16-22)28(21-4-2-6-23(33)17-21)36-13-11-35(12-14-36)18-19-7-8-24-25(15-19)31(41)37(30(24)40)26-9-10-27(38)34-29(26)39/h1-8,15-17,26,28H,9-14,18H2,(H,34,38,39) |
| InChIKey | FMKQSTZSJBBUCJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|