C36H37F2N5O4 — CID 177163418
5-[[4-(4-benzhydrylpiperazin-1-yl)-3,3-difluoropiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177163418) has the molecular formula C36H37F2N5O4 and a molecular weight of 641.72 g/mol. Its IUPAC name is 5-[[4-(4-benzhydrylpiperazin-1-yl)-3,3-difluoropiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-(4-benzhydrylpiperazin-1-yl)-3,3-difluoropiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177163418 |
| Molecular Formula | C36H37F2N5O4 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 5-[[4-(4-benzhydrylpiperazin-1-yl)-3,3-difluoropiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CCC(N5CCN(C(c6ccccc6)c6ccccc6)CC5)C(F)(F)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H37F2N5O4/c37-36(38)23-40(22-24-11-12-27-28(21-24)35(47)43(34(27)46)29-13-14-31(44)39-33(29)45)16-15-30(36)41-17-19-42(20-18-41)32(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-12,21,29-30,32H,13-20,22-23H2,(H,39,44,45) |
| InChIKey | RSRRUQIQHSKCEH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|