C29H33F2N5O3 — CID 175906422
3-[6-[[3,3-difluoro-4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175906422) has the molecular formula C29H33F2N5O3 and a molecular weight of 537.61 g/mol. Its IUPAC name is 3-[6-[[3,3-difluoro-4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[3,3-difluoro-4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175906422 |
| Molecular Formula | C29H33F2N5O3 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 3-[6-[[3,3-difluoro-4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCC(N5CCN(c6ccccc6)CC5)C(F)(F)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H33F2N5O3/c30-29(31)19-33(11-10-25(29)35-14-12-34(13-15-35)22-4-2-1-3-5-22)17-20-6-7-23-21(16-20)18-36(28(23)39)24-8-9-26(37)32-27(24)38/h1-7,16,24-25H,8-15,17-19H2,(H,32,37,38) |
| InChIKey | QIWWHYXLWDQYOQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|