C30H28N4O4 — CID 171829291
5-(4-benzhydrylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 171829291) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 5-(4-benzhydrylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-(4-benzhydrylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 171829291 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 5-(4-benzhydrylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(C(c5ccccc5)c5ccccc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H28N4O4/c35-26-14-13-25(28(36)31-26)34-29(37)23-12-11-22(19-24(23)30(34)38)32-15-17-33(18-16-32)27(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-12,19,25,27H,13-18H2,(H,31,35,36) |
| InChIKey | INNSSLIFIGSLHE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|