C22H27ClN4O4 — CID 171705610
5-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride (PubChem CID 171705610) has the molecular formula C22H27ClN4O4 and a molecular weight of 446.94 g/mol. Its IUPAC name is 5-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 5-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171705610 |
| Molecular Formula | C22H27ClN4O4 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 5-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2C(=O)c3ccc(N4CCC5(CCNCC5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H26N4O4.ClH/c27-18-4-3-17(19(28)24-18)26-20(29)15-2-1-14(13-16(15)21(26)30)25-11-7-22(8-12-25)5-9-23-10-6-22;/h1-2,13,17,23H,3-12H2,(H,24,27,28);1H |
| InChIKey | QGAAYXUCBQEBKU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|