C29H34N6O4 — CID 165136867
2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperazin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 165136867) has the molecular formula C29H34N6O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperazin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperazin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 165136867 |
| Molecular Formula | C29H34N6O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperazin-1-ylmethyl)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(Cc5ccc(CN6CCNCC6)cc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H34N6O4/c36-26-8-7-25(27(37)31-26)35-28(38)23-6-5-22(17-24(23)29(35)39)34-15-13-33(14-16-34)19-21-3-1-20(2-4-21)18-32-11-9-30-10-12-32/h1-6,17,25,30H,7-16,18-19H2,(H,31,36,37) |
| InChIKey | FLOWLCKPJKNRAB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|