C25H25N5O5 — CID 170980218
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide (PubChem CID 170980218) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 170980218 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NC(=O)c4ccc(CN5CCNCC5)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25N5O5/c31-21-8-7-20(23(33)28-21)30-24(34)18-6-5-17(13-19(18)25(30)35)27-22(32)16-3-1-15(2-4-16)14-29-11-9-26-10-12-29/h1-6,13,20,26H,7-12,14H2,(H,27,32)(H,28,31,33) |
| InChIKey | WJJIPTHXSUFTDE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|