C25H28ClN5O4 — CID 171329186
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide;hydrochloride (PubChem CID 171329186) has the molecular formula C25H28ClN5O4 and a molecular weight of 497.98 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide;hydrochloride.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 171329186 |
| Molecular Formula | C25H28ClN5O4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-(piperazin-1-ylmethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C1CCC(N2Cc3cc(NC(=O)c4ccc(CN5CCNCC5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27N5O4.ClH/c31-22-8-7-21(24(33)28-22)30-15-18-13-19(5-6-20(18)25(30)34)27-23(32)17-3-1-16(2-4-17)14-29-11-9-26-10-12-29;/h1-6,13,21,26H,7-12,14-15H2,(H,27,32)(H,28,31,33);1H |
| InChIKey | FYDHHUZWYCJEBY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|