C26H21N3O5 — CID 171088472
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenoxybenzamide (PubChem CID 171088472) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenoxybenzamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 171088472 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-phenoxybenzamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)c4cccc(Oc5ccccc5)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H21N3O5/c30-23-12-11-22(25(32)28-23)29-15-17-13-18(9-10-21(17)26(29)33)27-24(31)16-5-4-8-20(14-16)34-19-6-2-1-3-7-19/h1-10,13-14,22H,11-12,15H2,(H,27,31)(H,28,30,32) |
| InChIKey | DTGOZYNEQILPSF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|