C18H21N5O5 — CID 166426847
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamoyl]-1,3,3-trimethylurea (PubChem CID 166426847) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamoyl]-1,3,3-trimethylurea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamoyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 166426847 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamoyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)C(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H21N5O5/c1-21(2)18(28)22(3)17(27)19-11-4-5-12-10(8-11)9-23(16(12)26)13-6-7-14(24)20-15(13)25/h4-5,8,13H,6-7,9H2,1-3H3,(H,19,27)(H,20,24,25) |
| InChIKey | AKFXIUAMWPBSEV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|