C20H19BrN4O4 — CID 177188047
3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4,5-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 177188047) has the molecular formula C20H19BrN4O4 and a molecular weight of 459.30 g/mol. Its IUPAC name is 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4,5-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4,5-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177188047 |
| Molecular Formula | C20H19BrN4O4 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4,5-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1[nH]c(C(=O)Nc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c(Br)c1C |
| InChI | InChI=1S/C20H19BrN4O4/c1-9-10(2)22-17(16(9)21)19(28)23-12-3-4-13-11(7-12)8-25(20(13)29)14-5-6-15(26)24-18(14)27/h3-4,7,14,22H,5-6,8H2,1-2H3,(H,23,28)(H,24,26,27) |
| InChIKey | WEZWQIDJTSAYDF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|