C22H19BrN4O5 — CID 177188016
3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide (PubChem CID 177188016) has the molecular formula C22H19BrN4O5 and a molecular weight of 499.32 g/mol. Its IUPAC name is 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 177188016 |
| Molecular Formula | C22H19BrN4O5 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)c4[nH]c5c(c4Br)C(=O)CCC5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H19BrN4O5/c23-18-17-13(2-1-3-15(17)28)25-19(18)21(31)24-11-4-5-12-10(8-11)9-27(22(12)32)14-6-7-16(29)26-20(14)30/h4-5,8,14,25H,1-3,6-7,9H2,(H,24,31)(H,26,29,30) |
| InChIKey | JYJYMQWPUQEHEX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|