C25H24N4O4 — CID 177188184
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,5,7-trimethyl-1H-indole-2-carboxamide (PubChem CID 177188184) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,5,7-trimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,5,7-trimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 177188184 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,5,7-trimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)Nc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)c(C)c2c1 |
| InChI | InChI=1S/C25H24N4O4/c1-12-8-13(2)21-18(9-12)14(3)22(28-21)24(32)26-16-4-5-17-15(10-16)11-29(25(17)33)19-6-7-20(30)27-23(19)31/h4-5,8-10,19,28H,6-7,11H2,1-3H3,(H,26,32)(H,27,30,31) |
| InChIKey | LBRPUGMFIMBIOG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|