C26H25N5O5 — CID 177188021
5-acetamido-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide (PubChem CID 177188021) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 5-acetamido-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide.
| Compound Name | 5-acetamido-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 177188021 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 5-acetamido-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)[nH]c2ccc(NC(C)=O)cc12 |
| InChI | InChI=1S/C26H25N5O5/c1-3-17-19-11-16(27-13(2)32)5-7-20(19)29-23(17)25(35)28-15-4-6-18-14(10-15)12-31(26(18)36)21-8-9-22(33)30-24(21)34/h4-7,10-11,21,29H,3,8-9,12H2,1-2H3,(H,27,32)(H,28,35)(H,30,33,34) |
| InChIKey | VZECCEMWIMEPAU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|