C22H17ClN4O4 — CID 177187872
4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1H-indole-2-carboxamide (PubChem CID 177187872) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 177187872 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1H-indole-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)c4cc5c(Cl)cccc5[nH]4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H17ClN4O4/c23-15-2-1-3-16-14(15)9-17(25-16)20(29)24-12-4-5-13-11(8-12)10-27(22(13)31)18-6-7-19(28)26-21(18)30/h1-5,8-9,18,25H,6-7,10H2,(H,24,29)(H,26,28,30) |
| InChIKey | XJEILWUIXUKVES-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|