C23H18N4O5 — CID 166425804
N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 166425804) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 166425804 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(NC(=O)c4cc5ccccc5c(=O)[nH]4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18N4O5/c28-19-8-7-18(22(31)26-19)27-11-13-5-6-14(10-16(13)23(27)32)24-21(30)17-9-12-3-1-2-4-15(12)20(29)25-17/h1-6,9-10,18H,7-8,11H2,(H,24,30)(H,25,29)(H,26,28,31) |
| InChIKey | VGRBIOPMUXTYLH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|