C21H17N5O4 — CID 156501754
N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-5H-pyrrolo[2,3-b]pyridine-4-carboxamide (PubChem CID 156501754) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-5H-pyrrolo[2,3-b]pyridine-4-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-5H-pyrrolo[2,3-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 156501754 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-5H-pyrrolo[2,3-b]pyridine-4-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(NC(=O)C4=C5C=CN=C5N=CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17N5O4/c27-17-4-3-16(20(29)25-17)26-10-11-1-2-12(9-15(11)21(26)30)24-19(28)14-6-8-23-18-13(14)5-7-22-18/h1-2,5,7-9,16H,3-4,6,10H2,(H,24,28)(H,25,27,29) |
| InChIKey | DGDYEFFUOQROPS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|