C19H15F3N4O4S — CID 166425817
N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 166425817) has the molecular formula C19H15F3N4O4S and a molecular weight of 452.41 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 166425817 |
| Molecular Formula | C19H15F3N4O4S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C1CCC(N2Cc3ccc(NC(=O)Cc4csc(C(F)(F)F)n4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H15F3N4O4S/c20-19(21,22)18-24-11(8-31-18)6-15(28)23-10-2-1-9-7-26(17(30)12(9)5-10)13-3-4-14(27)25-16(13)29/h1-2,5,8,13H,3-4,6-7H2,(H,23,28)(H,25,27,29) |
| InChIKey | WZALBDQZBCEISG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|